C21H24N4O4 — CID 31235669
N-[4-[4-(2-nitrophenyl)piperazin-1-yl]-4-oxobutyl]benzamide (PubChem CID 31235669) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[4-[4-(2-nitrophenyl)piperazin-1-yl]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[4-(2-nitrophenyl)piperazin-1-yl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 31235669 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-[4-[4-(2-nitrophenyl)piperazin-1-yl]-4-oxobutyl]benzamide |
| SMILES | O=C(NCCCC(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1)c1ccccc1 |
| InChI | InChI=1S/C21H24N4O4/c26-20(11-6-12-22-21(27)17-7-2-1-3-8-17)24-15-13-23(14-16-24)18-9-4-5-10-19(18)25(28)29/h1-5,7-10H,6,11-16H2,(H,22,27) |
| InChIKey | KNDAQJZKPBIXTH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|