C13H19N5O3S — CID 31246771
4-methoxy-N-methyl-N-[(1-propyltetrazol-5-yl)methyl]benzenesulfonamide (PubChem CID 31246771) has the molecular formula C13H19N5O3S and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-methoxy-N-methyl-N-[(1-propyltetrazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-methyl-N-[(1-propyltetrazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 31246771 |
| Molecular Formula | C13H19N5O3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-methoxy-N-methyl-N-[(1-propyltetrazol-5-yl)methyl]benzenesulfonamide |
| SMILES | CCCn1nnnc1CN(C)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H19N5O3S/c1-4-9-18-13(14-15-16-18)10-17(2)22(19,20)12-7-5-11(21-3)6-8-12/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | NXOYVXBQZWEQJW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |