C19H23NO9 — CID 3126937
(2,3,4-triacetyloxy-5-anilino-5-oxopentyl) acetate (PubChem CID 3126937) has the molecular formula C19H23NO9 and a molecular weight of 409.39 g/mol. Its IUPAC name is (2,3,4-triacetyloxy-5-anilino-5-oxopentyl) acetate.
| Compound Name | (2,3,4-triacetyloxy-5-anilino-5-oxopentyl) acetate |
|---|---|
| PubChem CID | 3126937 |
| Molecular Formula | C19H23NO9 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | (2,3,4-triacetyloxy-5-anilino-5-oxopentyl) acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H23NO9/c1-11(21)26-10-16(27-12(2)22)17(28-13(3)23)18(29-14(4)24)19(25)20-15-8-6-5-7-9-15/h5-9,16-18H,10H2,1-4H3,(H,20,25) |
| InChIKey | YMLCCAYVPRMTRM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|