C20H25NO9 — CID 538892
[2,3,4-triacetyloxy-5-(2-methylanilino)-5-oxopentyl] acetate (PubChem CID 538892) has the molecular formula C20H25NO9 and a molecular weight of 423.42 g/mol. Its IUPAC name is [2,3,4-triacetyloxy-5-(2-methylanilino)-5-oxopentyl] acetate.
| Compound Name | [2,3,4-triacetyloxy-5-(2-methylanilino)-5-oxopentyl] acetate |
|---|---|
| PubChem CID | 538892 |
| Molecular Formula | C20H25NO9 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [2,3,4-triacetyloxy-5-(2-methylanilino)-5-oxopentyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C20H25NO9/c1-11-8-6-7-9-16(11)21-20(26)19(30-15(5)25)18(29-14(4)24)17(28-13(3)23)10-27-12(2)22/h6-9,17-19H,10H2,1-5H3,(H,21,26) |
| InChIKey | TXAWVGRHXVYUQW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|