C16H22ClN3O2S — CID 31281610
(5S)-3-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-5-(2-methylpropyl)imidazolidine-2,4-dione (PubChem CID 31281610) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is (5S)-3-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-5-(2-methylpropyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31281610 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (5S)-3-[[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]methyl]-5-(2-methylpropyl)imidazolidine-2,4-dione |
| SMILES | C=CCN(Cc1ccc(Cl)s1)CN1C(=O)N[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C16H22ClN3O2S/c1-4-7-19(9-12-5-6-14(17)23-12)10-20-15(21)13(8-11(2)3)18-16(20)22/h4-6,11,13H,1,7-10H2,2-3H3,(H,18,22)/t13-/m0/s1 |
| InChIKey | KWYQWWWWORBKCS-ZDUSSCGKSA-N |
| XLogP | 3.31 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|