C16H19N3O3S2 — CID 31289951
N-(3-methyl-1,3-thiazol-2-ylidene)-2-piperidin-1-ylsulfonylbenzamide (PubChem CID 31289951) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(3-methyl-1,3-thiazol-2-ylidene)-2-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3-methyl-1,3-thiazol-2-ylidene)-2-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 31289951 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-(3-methyl-1,3-thiazol-2-ylidene)-2-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cn1ccs/c1=N\C(=O)c1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H19N3O3S2/c1-18-11-12-23-16(18)17-15(20)13-7-3-4-8-14(13)24(21,22)19-9-5-2-6-10-19/h3-4,7-8,11-12H,2,5-6,9-10H2,1H3/b17-16- |
| InChIKey | CSSWFSAQAFZYGN-MSUUIHNZSA-N |
| XLogP | 2.00 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |