C22H22N4O4S2 — CID 55602026
2-piperidin-1-ylsulfonyl-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide (PubChem CID 55602026) has the molecular formula C22H22N4O4S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-piperidin-1-ylsulfonyl-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-piperidin-1-ylsulfonyl-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55602026 |
| Molecular Formula | C22H22N4O4S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 2-piperidin-1-ylsulfonyl-N-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(NC(=O)c2ccccc2S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H22N4O4S2/c27-20(25-22-23-12-15-31-22)16-8-10-17(11-9-16)24-21(28)18-6-2-3-7-19(18)32(29,30)26-13-4-1-5-14-26/h2-3,6-12,15H,1,4-5,13-14H2,(H,24,28)(H,23,25,27) |
| InChIKey | WICFNDJWRKUYAZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |