C17H21IN4O3 — CID 3129967
N-(4-iodophenyl)-3-[(2-oxo-2-piperidin-1-ylacetyl)hydrazinylidene]butanamide (PubChem CID 3129967) has the molecular formula C17H21IN4O3 and a molecular weight of 456.28 g/mol. Its IUPAC name is N-(4-iodophenyl)-3-[(2-oxo-2-piperidin-1-ylacetyl)hydrazinylidene]butanamide.
| Compound Name | N-(4-iodophenyl)-3-[(2-oxo-2-piperidin-1-ylacetyl)hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 3129967 |
| Molecular Formula | C17H21IN4O3 |
| Molecular Weight | 456.28 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-(4-iodophenyl)-3-[(2-oxo-2-piperidin-1-ylacetyl)hydrazinylidene]butanamide |
| SMILES | CC(CC(=O)Nc1ccc(I)cc1)=NNC(=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H21IN4O3/c1-12(11-15(23)19-14-7-5-13(18)6-8-14)20-21-16(24)17(25)22-9-3-2-4-10-22/h5-8H,2-4,9-11H2,1H3,(H,19,23)(H,21,24) |
| InChIKey | GOWJLZFJWVQVQJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|