C12H18ClN7O — CID 3130269
2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylacetamide (PubChem CID 3130269) has the molecular formula C12H18ClN7O and a molecular weight of 311.78 g/mol. Its IUPAC name is 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylacetamide.
| Compound Name | 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 3130269 |
| Molecular Formula | C12H18ClN7O |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(C#N)c1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H18ClN7O/c1-5-19(6-2)9(21)7-20(8-14)12-16-10(13)15-11(17-12)18(3)4/h5-7H2,1-4H3 |
| InChIKey | YSWQHLZGMSJWCD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|