C8H10Cl2N6 — CID 911356
[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-(2-chloroethyl)cyanamide (PubChem CID 911356) has the molecular formula C8H10Cl2N6 and a molecular weight of 261.12 g/mol. Its IUPAC name is [4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-(2-chloroethyl)cyanamide.
| Compound Name | [4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-(2-chloroethyl)cyanamide |
|---|---|
| PubChem CID | 911356 |
| Molecular Formula | C8H10Cl2N6 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | [4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-(2-chloroethyl)cyanamide |
| SMILES | CN(C)c1nc(Cl)nc(N(C#N)CCCl)n1 |
| InChI | InChI=1S/C8H10Cl2N6/c1-15(2)7-12-6(10)13-8(14-7)16(5-11)4-3-9/h3-4H2,1-2H3 |
| InChIKey | HVGQKNRYMZDGPJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 68.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|