C25H25N3O — CID 3133345
3-(4-butoxyphenyl)-5-(4-methylphenyl)-4-phenyl-1,2,4-triazole (PubChem CID 3133345) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-5-(4-methylphenyl)-4-phenyl-1,2,4-triazole.
| Compound Name | 3-(4-butoxyphenyl)-5-(4-methylphenyl)-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 3133345 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 3-(4-butoxyphenyl)-5-(4-methylphenyl)-4-phenyl-1,2,4-triazole |
| SMILES | CCCCOc1ccc(-c2nnc(-c3ccc(C)cc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O/c1-3-4-18-29-23-16-14-21(15-17-23)25-27-26-24(20-12-10-19(2)11-13-20)28(25)22-8-6-5-7-9-22/h5-17H,3-4,18H2,1-2H3 |
| InChIKey | NYLLKNVBHBYALG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|