C27H28N4O3 — CID 31333795
4-(benzimidazol-1-yl)-N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 31333795) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 4-(benzimidazol-1-yl)-N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 31333795 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 4-(benzimidazol-1-yl)-N-[(2S)-2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | COc1ccc([C@@H](CNC(=O)c2ccc(-n3cnc4ccccc43)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H28N4O3/c1-33-23-12-8-20(9-13-23)26(30-14-16-34-17-15-30)18-28-27(32)21-6-10-22(11-7-21)31-19-29-24-4-2-3-5-25(24)31/h2-13,19,26H,14-18H2,1H3,(H,28,32)/t26-/m1/s1 |
| InChIKey | XNVRPKNIZUSEAN-AREMUKBSSA-N |
| XLogP | 3.84 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |