C24H19ClN4O4 — CID 31357334
4-(4-chloro-2-nitrophenoxy)-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]benzamide (PubChem CID 31357334) has the molecular formula C24H19ClN4O4 and a molecular weight of 462.89 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenoxy)-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]benzamide.
| Compound Name | 4-(4-chloro-2-nitrophenoxy)-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 31357334 |
| Molecular Formula | C24H19ClN4O4 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 4-(4-chloro-2-nitrophenoxy)-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]benzamide |
| SMILES | Cn1ccnc1[C@H](NC(=O)c1ccc(Oc2ccc(Cl)cc2[N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C24H19ClN4O4/c1-28-14-13-26-23(28)22(16-5-3-2-4-6-16)27-24(30)17-7-10-19(11-8-17)33-21-12-9-18(25)15-20(21)29(31)32/h2-15,22H,1H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | PTJSSIYFHPIXKZ-JOCHJYFZSA-N |
| XLogP | 5.29 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|