C20H19ClN2O3 — CID 3136468
ethyl N-[11-(3-chloropropanoyl)benzo[b][1]benzazepin-2-yl]carbamate (PubChem CID 3136468) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is ethyl N-[11-(3-chloropropanoyl)benzo[b][1]benzazepin-2-yl]carbamate.
| Compound Name | ethyl N-[11-(3-chloropropanoyl)benzo[b][1]benzazepin-2-yl]carbamate |
|---|---|
| PubChem CID | 3136468 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | ethyl N-[11-(3-chloropropanoyl)benzo[b][1]benzazepin-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CCCl)c1ccccc1C=C2 |
| InChI | InChI=1S/C20H19ClN2O3/c1-2-26-20(25)22-16-10-9-15-8-7-14-5-3-4-6-17(14)23(18(15)13-16)19(24)11-12-21/h3-10,13H,2,11-12H2,1H3,(H,22,25) |
| InChIKey | ZNYTWVQXLLGWKX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|