C22H28ClN3O3S — CID 43834221
[3-[2-(ethoxycarbonylamino)phenothiazin-10-yl]-3-oxopropyl]-diethylazanium chloride (PubChem CID 43834221) has the molecular formula C22H28ClN3O3S and a molecular weight of 450.00 g/mol. Its IUPAC name is [3-[2-(ethoxycarbonylamino)phenothiazin-10-yl]-3-oxopropyl]-diethylazanium chloride.
| Compound Name | [3-[2-(ethoxycarbonylamino)phenothiazin-10-yl]-3-oxopropyl]-diethylazanium chloride |
|---|---|
| PubChem CID | 43834221 |
| Molecular Formula | C22H28ClN3O3S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [3-[2-(ethoxycarbonylamino)phenothiazin-10-yl]-3-oxopropyl]-diethylazanium chloride |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CC[NH+](CC)CC)c1ccccc1S2.[Cl-] |
| InChI | InChI=1S/C22H27N3O3S.ClH/c1-4-24(5-2)14-13-21(26)25-17-9-7-8-10-19(17)29-20-12-11-16(15-18(20)25)23-22(27)28-6-3;/h7-12,15H,4-6,13-14H2,1-3H3,(H,23,27);1H |
| InChIKey | VHNXQKLWIQHSOY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |