C25H21FN4O4S — CID 3137270
2-[8-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanyl-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 3137270) has the molecular formula C25H21FN4O4S and a molecular weight of 492.53 g/mol. Its IUPAC name is 2-[8-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanyl-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[8-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanyl-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3137270 |
| Molecular Formula | C25H21FN4O4S |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 2-[8-ethyl-2-(4-fluorophenyl)quinazolin-4-yl]sulfanyl-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | CCc1cccc2c(SCC(=O)Nc3ccc([N+](=O)[O-])cc3OC)nc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C25H21FN4O4S/c1-3-15-5-4-6-19-23(15)28-24(16-7-9-17(26)10-8-16)29-25(19)35-14-22(31)27-20-12-11-18(30(32)33)13-21(20)34-2/h4-13H,3,14H2,1-2H3,(H,27,31) |
| InChIKey | CNZQOQBTMGHIPI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|