About [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate
[4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate (PubChem CID 31391128) has the molecular formula C18H19BrN2O4S
and a molecular weight of 439.33 g/mol. Its IUPAC name is [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate |
| PubChem CID | 31391128 |
| Molecular Formula | C18H19BrN2O4S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate |
| SMILES | CC(=O)N1CCN(c2ccc(OS(=O)(=O)c3ccccc3Br)cc2)CC1 |
| InChI | InChI=1S/C18H19BrN2O4S/c1-14(22)20-10-12-21(13-11-20)15-6-8-16(9-7-15)25-26(23,24)18-5-3-2-4-17(18)19/h2-9H,10-13H2,1H3 |
| InChIKey | QKWLTSYDHMZRRL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate?
The IUPAC name of [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate (CID 31391128) is [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate.
What is the SMILES notation for [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate?
The canonical SMILES for [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate is CC(=O)N1CCN(c2ccc(OS(=O)(=O)c3ccccc3Br)cc2)CC1.
What is the InChIKey of [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate?
The InChIKey is QKWLTSYDHMZRRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrN2O4S/c1-14(22)20-10-12-21(13-11-20)15-6-8-16(9-7-15)25-26(23,24)18-5-3-2-4-17(18)19/h2-9H,10-13H2,1H3.
What are the key properties of [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate?
[4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate has a molecular weight of 439.33 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-acetylpiperazin-1-yl)phenyl] 2-bromobenzenesulfonate is sourced from PubChem (CID 31391128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).