C24H28N4OS — CID 3141505
N-[[4-(diethylamino)phenyl]methylideneamino]-2-(2,8-dimethylquinolin-4-yl)sulfanylacetamide (PubChem CID 3141505) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-2-(2,8-dimethylquinolin-4-yl)sulfanylacetamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-(2,8-dimethylquinolin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3141505 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-2-(2,8-dimethylquinolin-4-yl)sulfanylacetamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)CSc2cc(C)nc3c(C)cccc23)cc1 |
| InChI | InChI=1S/C24H28N4OS/c1-5-28(6-2)20-12-10-19(11-13-20)15-25-27-23(29)16-30-22-14-18(4)26-24-17(3)8-7-9-21(22)24/h7-15H,5-6,16H2,1-4H3,(H,27,29) |
| InChIKey | CXICNCXIWCGUAH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|