C21H21NO5S — CID 3144219
ethyl 2-[(2-oxochromene-3-carbonyl)amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate (PubChem CID 3144219) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is ethyl 2-[(2-oxochromene-3-carbonyl)amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-oxochromene-3-carbonyl)amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3144219 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | ethyl 2-[(2-oxochromene-3-carbonyl)amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(NC(=O)c2cc3ccccc3oc2=O)SC2CCCCC12 |
| InChI | InChI=1S/C21H21NO5S/c1-2-26-21(25)17-13-8-4-6-10-16(13)28-19(17)22-18(23)14-11-12-7-3-5-9-15(12)27-20(14)24/h3,5,7,9,11,13,16H,2,4,6,8,10H2,1H3,(H,22,23) |
| InChIKey | FZUKDOCYMSNRLM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|