C19H22F3N5O — CID 31536285
N-(2-ethylphenyl)-2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]acetamide (PubChem CID 31536285) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 31536285 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C19H22F3N5O/c1-2-14-5-3-4-6-15(14)24-17(28)13-26-9-11-27(12-10-26)18-23-8-7-16(25-18)19(20,21)22/h3-8H,2,9-13H2,1H3,(H,24,28) |
| InChIKey | NLIUANZBBOKWGI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |