C12H8F2N2OS — CID 31536570
2-(3,4-difluorophenyl)sulfanylpyridine-3-carboxamide (PubChem CID 31536570) has the molecular formula C12H8F2N2OS and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanylpyridine-3-carboxamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 31536570 |
| Molecular Formula | C12H8F2N2OS |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanylpyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1Sc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H8F2N2OS/c13-9-4-3-7(6-10(9)14)18-12-8(11(15)17)2-1-5-16-12/h1-6H,(H2,15,17) |
| InChIKey | JRFADLJWVPVRLU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |