C23H23N3 — CID 31560301
(1R)-N-[(1-benzylpyrazol-4-yl)methyl]-1-naphthalen-1-ylethanamine (PubChem CID 31560301) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is (1R)-N-[(1-benzylpyrazol-4-yl)methyl]-1-naphthalen-1-ylethanamine.
| Compound Name | (1R)-N-[(1-benzylpyrazol-4-yl)methyl]-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 31560301 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (1R)-N-[(1-benzylpyrazol-4-yl)methyl]-1-naphthalen-1-ylethanamine |
| SMILES | C[C@@H](NCc1cnn(Cc2ccccc2)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H23N3/c1-18(22-13-7-11-21-10-5-6-12-23(21)22)24-14-20-15-25-26(17-20)16-19-8-3-2-4-9-19/h2-13,15,17-18,24H,14,16H2,1H3/t18-/m1/s1 |
| InChIKey | UFWYSGWVRTWTQO-GOSISDBHSA-N |
| XLogP | 4.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |