C17H19N3O — CID 81391965
(1R)-N-[(1-benzylpyrazol-4-yl)methyl]-1-(furan-2-yl)ethanamine (PubChem CID 81391965) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is (1R)-N-[(1-benzylpyrazol-4-yl)methyl]-1-(furan-2-yl)ethanamine.
| Compound Name | (1R)-N-[(1-benzylpyrazol-4-yl)methyl]-1-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 81391965 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (1R)-N-[(1-benzylpyrazol-4-yl)methyl]-1-(furan-2-yl)ethanamine |
| SMILES | C[C@@H](NCc1cnn(Cc2ccccc2)c1)c1ccco1 |
| InChI | InChI=1S/C17H19N3O/c1-14(17-8-5-9-21-17)18-10-16-11-19-20(13-16)12-15-6-3-2-4-7-15/h2-9,11,13-14,18H,10,12H2,1H3/t14-/m1/s1 |
| InChIKey | JNQGKQPJGMKOIS-CQSZACIVSA-N |
| XLogP | 3.38 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |