C14H10N4S2 — CID 31618595
N-(1,3-benzothiazol-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 31618595) has the molecular formula C14H10N4S2 and a molecular weight of 298.40 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 31618595 |
| Molecular Formula | C14H10N4S2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | c1ccc2sc(CNc3ncnc4sccc34)nc2c1 |
| InChI | InChI=1S/C14H10N4S2/c1-2-4-11-10(3-1)18-12(20-11)7-15-13-9-5-6-19-14(9)17-8-16-13/h1-6,8H,7H2,(H,15,16,17) |
| InChIKey | LMXUEJHUPSSAAJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |