C28H26N2O5S — CID 3173756
N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-methoxyphenyl)-2-oxochromene-3-carboxamide (PubChem CID 3173756) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-methoxyphenyl)-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-methoxyphenyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3173756 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | N-[2-(cyclopentylamino)-2-oxo-1-thiophen-2-ylethyl]-N-(3-methoxyphenyl)-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc(N(C(=O)c2cc3ccccc3oc2=O)C(C(=O)NC2CCCC2)c2cccs2)c1 |
| InChI | InChI=1S/C28H26N2O5S/c1-34-21-12-6-11-20(17-21)30(27(32)22-16-18-8-2-5-13-23(18)35-28(22)33)25(24-14-7-15-36-24)26(31)29-19-9-3-4-10-19/h2,5-8,11-17,19,25H,3-4,9-10H2,1H3,(H,29,31) |
| InChIKey | IHURYAOZUYEMKR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|