C9H9ClN6O — CID 3177752
2-[5-(4-chlorophenyl)tetrazol-2-yl]-N'-hydroxyethanimidamide (PubChem CID 3177752) has the molecular formula C9H9ClN6O and a molecular weight of 252.67 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 3177752 |
| Molecular Formula | C9H9ClN6O |
| Molecular Weight | 252.67 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-[5-(4-chlorophenyl)tetrazol-2-yl]-N'-hydroxyethanimidamide |
| SMILES | NC(Cn1nnc(-c2ccc(Cl)cc2)n1)=NO |
| InChI | InChI=1S/C9H9ClN6O/c10-7-3-1-6(2-4-7)9-12-15-16(13-9)5-8(11)14-17/h1-4,17H,5H2,(H2,11,14) |
| InChIKey | GWJFYYKBOAJYTD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.67 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|