C17H18N4O3S2 — CID 31843072
N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 31843072) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 31843072 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CN(Cc1cnn(C)c1)C(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H18N4O3S2/c1-20(11-13-10-18-21(2)12-13)17(22)14-5-7-15(8-6-14)19-26(23,24)16-4-3-9-25-16/h3-10,12,19H,11H2,1-2H3 |
| InChIKey | QQKJKLPLOMTKPX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |