C22H29NO8 — CID 31983589
ethyl 1-[2-[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 31983589) has the molecular formula C22H29NO8 and a molecular weight of 435.47 g/mol. Its IUPAC name is ethyl 1-[2-[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31983589 |
| Molecular Formula | C22H29NO8 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | ethyl 1-[2-[(E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)/C=C/c2cc(OC)c(OC)cc2OC)CC1 |
| InChI | InChI=1S/C22H29NO8/c1-5-30-22(26)15-8-10-23(11-9-15)20(24)14-31-21(25)7-6-16-12-18(28-3)19(29-4)13-17(16)27-2/h6-7,12-13,15H,5,8-11,14H2,1-4H3/b7-6+ |
| InChIKey | JJGBUMNDJBBKPP-VOTSOKGWSA-N |
| XLogP | 2.07 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|