C24H27NO6 — CID 46669682
[2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 46669682) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is [2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46669682 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] (E)-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C(=O)OCC(=O)N1c2ccccc2CCC1C |
| InChI | InChI=1S/C24H27NO6/c1-16-9-10-17-7-5-6-8-19(17)25(16)23(26)15-31-24(27)12-11-18-13-21(29-3)22(30-4)14-20(18)28-2/h5-8,11-14,16H,9-10,15H2,1-4H3/b12-11+ |
| InChIKey | UIHNMJYLWVGJLV-VAWYXSNFSA-N |
| XLogP | 3.64 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|