C23H28N4O4 — CID 3204821
N'-[2-(benzylamino)-2-oxoethyl]-N'-(oxolan-2-ylmethyl)-N-pyridin-2-ylbutanediamide (PubChem CID 3204821) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N'-[2-(benzylamino)-2-oxoethyl]-N'-(oxolan-2-ylmethyl)-N-pyridin-2-ylbutanediamide.
| Compound Name | N'-[2-(benzylamino)-2-oxoethyl]-N'-(oxolan-2-ylmethyl)-N-pyridin-2-ylbutanediamide |
|---|---|
| PubChem CID | 3204821 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N'-[2-(benzylamino)-2-oxoethyl]-N'-(oxolan-2-ylmethyl)-N-pyridin-2-ylbutanediamide |
| SMILES | O=C(CN(CC1CCCO1)C(=O)CCC(=O)Nc1ccccn1)NCc1ccccc1 |
| InChI | InChI=1S/C23H28N4O4/c28-21(26-20-10-4-5-13-24-20)11-12-23(30)27(16-19-9-6-14-31-19)17-22(29)25-15-18-7-2-1-3-8-18/h1-5,7-8,10,13,19H,6,9,11-12,14-17H2,(H,25,29)(H,24,26,28) |
| InChIKey | DVYSCEDSKIGPOZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |