C22H20N6O4S2 — CID 3219895
7-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3-(4-nitrophenyl)-[1,2]thiazolo[4,5-d]pyrimidine (PubChem CID 3219895) has the molecular formula C22H20N6O4S2 and a molecular weight of 496.57 g/mol. Its IUPAC name is 7-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3-(4-nitrophenyl)-[1,2]thiazolo[4,5-d]pyrimidine.
| Compound Name | 7-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3-(4-nitrophenyl)-[1,2]thiazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 3219895 |
| Molecular Formula | C22H20N6O4S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 7-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-3-(4-nitrophenyl)-[1,2]thiazolo[4,5-d]pyrimidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3ncnc4c(-c5ccc([N+](=O)[O-])cc5)nsc34)CC2)cc1 |
| InChI | InChI=1S/C22H20N6O4S2/c1-15-2-8-18(9-3-15)34(31,32)27-12-10-26(11-13-27)22-21-20(23-14-24-22)19(25-33-21)16-4-6-17(7-5-16)28(29)30/h2-9,14H,10-13H2,1H3 |
| InChIKey | AGPZYYAPICVVTI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 122.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|