C17H15ClN6O — CID 3232855
3-[6-(4-chlorophenyl)-2-(ethylamino)-7-oxopteridin-8-yl]propanenitrile (PubChem CID 3232855) has the molecular formula C17H15ClN6O and a molecular weight of 354.80 g/mol. Its IUPAC name is 3-[6-(4-chlorophenyl)-2-(ethylamino)-7-oxopteridin-8-yl]propanenitrile.
| Compound Name | 3-[6-(4-chlorophenyl)-2-(ethylamino)-7-oxopteridin-8-yl]propanenitrile |
|---|---|
| PubChem CID | 3232855 |
| Molecular Formula | C17H15ClN6O |
| Molecular Weight | 354.80 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 3-[6-(4-chlorophenyl)-2-(ethylamino)-7-oxopteridin-8-yl]propanenitrile |
| SMILES | CCNc1ncc2nc(-c3ccc(Cl)cc3)c(=O)n(CCC#N)c2n1 |
| InChI | InChI=1S/C17H15ClN6O/c1-2-20-17-21-10-13-15(23-17)24(9-3-8-19)16(25)14(22-13)11-4-6-12(18)7-5-11/h4-7,10H,2-3,9H2,1H3,(H,20,21,23) |
| InChIKey | BFQJYXIPLRMAGM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |