C19H12ClN5O2S — CID 3232974
3-[2-(3-chlorophenoxy)-7-oxo-6-thiophen-2-ylpteridin-8-yl]propanenitrile (PubChem CID 3232974) has the molecular formula C19H12ClN5O2S and a molecular weight of 409.86 g/mol. Its IUPAC name is 3-[2-(3-chlorophenoxy)-7-oxo-6-thiophen-2-ylpteridin-8-yl]propanenitrile.
| Compound Name | 3-[2-(3-chlorophenoxy)-7-oxo-6-thiophen-2-ylpteridin-8-yl]propanenitrile |
|---|---|
| PubChem CID | 3232974 |
| Molecular Formula | C19H12ClN5O2S |
| Molecular Weight | 409.86 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 3-[2-(3-chlorophenoxy)-7-oxo-6-thiophen-2-ylpteridin-8-yl]propanenitrile |
| SMILES | N#CCCn1c(=O)c(-c2cccs2)nc2cnc(Oc3cccc(Cl)c3)nc21 |
| InChI | InChI=1S/C19H12ClN5O2S/c20-12-4-1-5-13(10-12)27-19-22-11-14-17(24-19)25(8-3-7-21)18(26)16(23-14)15-6-2-9-28-15/h1-2,4-6,9-11H,3,8H2 |
| InChIKey | QEZDMAJFJSFBHT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |