C19H17N5O2S — CID 3233741
2-(ethylamino)-8-(4-methoxyphenyl)-6-thiophen-2-ylpteridin-7-one (PubChem CID 3233741) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 2-(ethylamino)-8-(4-methoxyphenyl)-6-thiophen-2-ylpteridin-7-one.
| Compound Name | 2-(ethylamino)-8-(4-methoxyphenyl)-6-thiophen-2-ylpteridin-7-one |
|---|---|
| PubChem CID | 3233741 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-(ethylamino)-8-(4-methoxyphenyl)-6-thiophen-2-ylpteridin-7-one |
| SMILES | CCNc1ncc2nc(-c3cccs3)c(=O)n(-c3ccc(OC)cc3)c2n1 |
| InChI | InChI=1S/C19H17N5O2S/c1-3-20-19-21-11-14-17(23-19)24(12-6-8-13(26-2)9-7-12)18(25)16(22-14)15-5-4-10-27-15/h4-11H,3H2,1-2H3,(H,20,21,23) |
| InChIKey | RKQQJQHHURTOTK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |