C25H26N6O2 — CID 3233250
8-[(3-methoxyphenyl)methyl]-2-(4-methylpiperazin-1-yl)-6-phenylpteridin-7-one (PubChem CID 3233250) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 8-[(3-methoxyphenyl)methyl]-2-(4-methylpiperazin-1-yl)-6-phenylpteridin-7-one.
| Compound Name | 8-[(3-methoxyphenyl)methyl]-2-(4-methylpiperazin-1-yl)-6-phenylpteridin-7-one |
|---|---|
| PubChem CID | 3233250 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 8-[(3-methoxyphenyl)methyl]-2-(4-methylpiperazin-1-yl)-6-phenylpteridin-7-one |
| SMILES | COc1cccc(Cn2c(=O)c(-c3ccccc3)nc3cnc(N4CCN(C)CC4)nc32)c1 |
| InChI | InChI=1S/C25H26N6O2/c1-29-11-13-30(14-12-29)25-26-16-21-23(28-25)31(17-18-7-6-10-20(15-18)33-2)24(32)22(27-21)19-8-4-3-5-9-19/h3-10,15-16H,11-14,17H2,1-2H3 |
| InChIKey | PRDFGMJLAZWUGM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |