C25H23ClN4O3 — CID 3233485
2-(3-chlorophenoxy)-8-[[(2R)-oxolan-2-yl]methyl]-6-(2-phenylethyl)pteridin-7-one (PubChem CID 3233485) has the molecular formula C25H23ClN4O3 and a molecular weight of 462.94 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-8-[[(2R)-oxolan-2-yl]methyl]-6-(2-phenylethyl)pteridin-7-one.
| Compound Name | 2-(3-chlorophenoxy)-8-[[(2R)-oxolan-2-yl]methyl]-6-(2-phenylethyl)pteridin-7-one |
|---|---|
| PubChem CID | 3233485 |
| Molecular Formula | C25H23ClN4O3 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-(3-chlorophenoxy)-8-[[(2R)-oxolan-2-yl]methyl]-6-(2-phenylethyl)pteridin-7-one |
| SMILES | O=c1c(CCc2ccccc2)nc2cnc(Oc3cccc(Cl)c3)nc2n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C25H23ClN4O3/c26-18-8-4-9-19(14-18)33-25-27-15-22-23(29-25)30(16-20-10-5-13-32-20)24(31)21(28-22)12-11-17-6-2-1-3-7-17/h1-4,6-9,14-15,20H,5,10-13,16H2/t20-/m1/s1 |
| InChIKey | NJDZHVTZBBYKHM-HXUWFJFHSA-N |
| XLogP | 4.60 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |