C25H24N4O3 — CID 3232690
8-[[(2R)-oxolan-2-yl]methyl]-2-phenoxy-6-(2-phenylethyl)pteridin-7-one (PubChem CID 3232690) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 8-[[(2R)-oxolan-2-yl]methyl]-2-phenoxy-6-(2-phenylethyl)pteridin-7-one.
| Compound Name | 8-[[(2R)-oxolan-2-yl]methyl]-2-phenoxy-6-(2-phenylethyl)pteridin-7-one |
|---|---|
| PubChem CID | 3232690 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 8-[[(2R)-oxolan-2-yl]methyl]-2-phenoxy-6-(2-phenylethyl)pteridin-7-one |
| SMILES | O=c1c(CCc2ccccc2)nc2cnc(Oc3ccccc3)nc2n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C25H24N4O3/c30-24-21(14-13-18-8-3-1-4-9-18)27-22-16-26-25(32-19-10-5-2-6-11-19)28-23(22)29(24)17-20-12-7-15-31-20/h1-6,8-11,16,20H,7,12-15,17H2/t20-/m1/s1 |
| InChIKey | TYZHNEOHPTWTBO-HXUWFJFHSA-N |
| XLogP | 3.94 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |