C24H40N4O4S — CID 3236138
N-[3-[benzyl(butyl)amino]propyl]-1-morpholin-4-ylsulfonylpiperidine-4-carboxamide (PubChem CID 3236138) has the molecular formula C24H40N4O4S and a molecular weight of 480.68 g/mol. Its IUPAC name is N-[3-[benzyl(butyl)amino]propyl]-1-morpholin-4-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-[benzyl(butyl)amino]propyl]-1-morpholin-4-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3236138 |
| Molecular Formula | C24H40N4O4S |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | N-[3-[benzyl(butyl)amino]propyl]-1-morpholin-4-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CCCCN(CCCNC(=O)C1CCN(S(=O)(=O)N2CCOCC2)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C24H40N4O4S/c1-2-3-13-26(21-22-8-5-4-6-9-22)14-7-12-25-24(29)23-10-15-27(16-11-23)33(30,31)28-17-19-32-20-18-28/h4-6,8-9,23H,2-3,7,10-21H2,1H3,(H,25,29) |
| InChIKey | NWBRGGBCZNAIGB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|