C25H30Cl2N2O3 — CID 3246672
(2R,7R)-9-(3,4-dichlorophenyl)-2,7-bis[(dimethylamino)methyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione (PubChem CID 3246672) has the molecular formula C25H30Cl2N2O3 and a molecular weight of 477.43 g/mol. Its IUPAC name is (2R,7R)-9-(3,4-dichlorophenyl)-2,7-bis[(dimethylamino)methyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione.
| Compound Name | (2R,7R)-9-(3,4-dichlorophenyl)-2,7-bis[(dimethylamino)methyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 3246672 |
| Molecular Formula | C25H30Cl2N2O3 |
| Molecular Weight | 477.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (2R,7R)-9-(3,4-dichlorophenyl)-2,7-bis[(dimethylamino)methyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione |
| SMILES | CN(C)C[C@H]1CCC2=C(C1=O)C(c1ccc(Cl)c(Cl)c1)C1=C(CC[C@H](CN(C)C)C1=O)O2 |
| InChI | InChI=1S/C25H30Cl2N2O3/c1-28(2)12-15-6-9-19-22(24(15)30)21(14-5-8-17(26)18(27)11-14)23-20(32-19)10-7-16(25(23)31)13-29(3)4/h5,8,11,15-16,21H,6-7,9-10,12-13H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | FEHKQTCFKALTRL-HZPDHXFCSA-N |
| XLogP | 4.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |