C25H32N2O4 — CID 3247318
benzyl N-[(S)-[(1S,2R)-2-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-1-methylcyclopropyl]-phenylmethyl]carbamate (PubChem CID 3247318) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is benzyl N-[(S)-[(1S,2R)-2-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-1-methylcyclopropyl]-phenylmethyl]carbamate.
| Compound Name | benzyl N-[(S)-[(1S,2R)-2-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-1-methylcyclopropyl]-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 3247318 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | benzyl N-[(S)-[(1S,2R)-2-[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-1-methylcyclopropyl]-phenylmethyl]carbamate |
| SMILES | COCCNC(=O)[C@H](C)[C@H]1C[C@]1(C)[C@H](NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O4/c1-18(23(28)26-14-15-30-3)21-16-25(21,2)22(20-12-8-5-9-13-20)27-24(29)31-17-19-10-6-4-7-11-19/h4-13,18,21-22H,14-17H2,1-3H3,(H,26,28)(H,27,29)/t18-,21-,22-,25+/m1/s1 |
| InChIKey | BXCJWVWJJYQBRU-FMNIHWTGSA-N |
| XLogP | 4.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|