C15H22NO3+ — CID 3248088
[2-(7-ethyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-trimethylazanium (PubChem CID 3248088) has the molecular formula C15H22NO3+ and a molecular weight of 264.34 g/mol. Its IUPAC name is [2-(7-ethyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-(7-ethyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 3248088 |
| Molecular Formula | C15H22NO3+ |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [2-(7-ethyl-2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]-trimethylazanium |
| SMILES | CCc1cc2c(cc1C(=O)C[N+](C)(C)C)OCCO2 |
| InChI | InChI=1S/C15H22NO3/c1-5-11-8-14-15(19-7-6-18-14)9-12(11)13(17)10-16(2,3)4/h8-9H,5-7,10H2,1-4H3/q+1 |
| InChIKey | ZWSRFEVIOWADCO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|