C18H28O6Si — CID 101477456
1-[7-(2-triethoxysilylethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone (PubChem CID 101477456) has the molecular formula C18H28O6Si and a molecular weight of 368.50 g/mol. Its IUPAC name is 1-[7-(2-triethoxysilylethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone.
| Compound Name | 1-[7-(2-triethoxysilylethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone |
|---|---|
| PubChem CID | 101477456 |
| Molecular Formula | C18H28O6Si |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-[7-(2-triethoxysilylethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethanone |
| SMILES | CCO[Si](CCc1cc2c(cc1C(C)=O)OCCO2)(OCC)OCC |
| InChI | InChI=1S/C18H28O6Si/c1-5-22-25(23-6-2,24-7-3)11-8-15-12-17-18(21-10-9-20-17)13-16(15)14(4)19/h12-13H,5-11H2,1-4H3 |
| InChIKey | DGCSRSXDBCIWHL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|