C19H18N2O3 — CID 32609032
cyanomethyl (3S)-1-(naphthalene-1-carbonyl)piperidine-3-carboxylate (PubChem CID 32609032) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is cyanomethyl (3S)-1-(naphthalene-1-carbonyl)piperidine-3-carboxylate.
| Compound Name | cyanomethyl (3S)-1-(naphthalene-1-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 32609032 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | cyanomethyl (3S)-1-(naphthalene-1-carbonyl)piperidine-3-carboxylate |
| SMILES | N#CCOC(=O)[C@H]1CCCN(C(=O)c2cccc3ccccc23)C1 |
| InChI | InChI=1S/C19H18N2O3/c20-10-12-24-19(23)15-7-4-11-21(13-15)18(22)17-9-3-6-14-5-1-2-8-16(14)17/h1-3,5-6,8-9,15H,4,7,11-13H2/t15-/m0/s1 |
| InChIKey | UHHMREZOUJYELG-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |