C21H32N4O2S — CID 3262573
2-[1-adamantylcarbamoyl(butyl)amino]-N-(5-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 3262573) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-[1-adamantylcarbamoyl(butyl)amino]-N-(5-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[1-adamantylcarbamoyl(butyl)amino]-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3262573 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[1-adamantylcarbamoyl(butyl)amino]-N-(5-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCN(CC(=O)Nc1ncc(C)s1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H32N4O2S/c1-3-4-5-25(13-18(26)23-19-22-12-14(2)28-19)20(27)24-21-9-15-6-16(10-21)8-17(7-15)11-21/h12,15-17H,3-11,13H2,1-2H3,(H,24,27)(H,22,23,26) |
| InChIKey | FLAYJVRIPJKMHI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |