C19H22N4O2S — CID 32632343
N-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-4-methoxy-1-phenylpyrazole-3-carboxamide (PubChem CID 32632343) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-4-methoxy-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-4-methoxy-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 32632343 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-thiophen-3-ylethyl]-4-methoxy-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)NC[C@H](c1ccsc1)N(C)C |
| InChI | InChI=1S/C19H22N4O2S/c1-22(2)16(14-9-10-26-13-14)11-20-19(24)18-17(25-3)12-23(21-18)15-7-5-4-6-8-15/h4-10,12-13,16H,11H2,1-3H3,(H,20,24)/t16-/m1/s1 |
| InChIKey | VZELSDFLCJPFTP-MRXNPFEDSA-N |
| XLogP | 2.98 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |