C17H18ClFN2S2 — CID 3271545
1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2-fluorophenyl)thiourea (PubChem CID 3271545) has the molecular formula C17H18ClFN2S2 and a molecular weight of 368.93 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 3271545 |
| Molecular Formula | C17H18ClFN2S2 |
| Molecular Weight | 368.93 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfanyl-2-methylpropyl]-3-(2-fluorophenyl)thiourea |
| SMILES | CC(CNC(=S)Nc1ccccc1F)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClFN2S2/c1-12(11-23-14-8-6-13(18)7-9-14)10-20-17(22)21-16-5-3-2-4-15(16)19/h2-9,12H,10-11H2,1H3,(H2,20,21,22) |
| InChIKey | UUFWNAWMSUYBQO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.93 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|