C23H23N3O4S — CID 3275380
2-[3-[2-(2-methoxy-5-methylphenyl)imino-1,3-thiazinan-3-yl]-3-oxopropyl]isoindole-1,3-dione (PubChem CID 3275380) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-[3-[2-(2-methoxy-5-methylphenyl)imino-1,3-thiazinan-3-yl]-3-oxopropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[2-(2-methoxy-5-methylphenyl)imino-1,3-thiazinan-3-yl]-3-oxopropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3275380 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[3-[2-(2-methoxy-5-methylphenyl)imino-1,3-thiazinan-3-yl]-3-oxopropyl]isoindole-1,3-dione |
| SMILES | COc1ccc(C)cc1/N=C1\SCCCN1C(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23N3O4S/c1-15-8-9-19(30-2)18(14-15)24-23-25(11-5-13-31-23)20(27)10-12-26-21(28)16-6-3-4-7-17(16)22(26)29/h3-4,6-9,14H,5,10-13H2,1-2H3/b24-23- |
| InChIKey | LEELFNFHUYPWCJ-VHXPQNKSSA-N |
| XLogP | 3.64 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|