C16H14BrCl2NO2 — CID 3277239
2-bromo-4-chloro-6-[(3-chloro-4-methoxyphenyl)iminomethyl]-3,5-dimethylphenol (PubChem CID 3277239) has the molecular formula C16H14BrCl2NO2 and a molecular weight of 403.10 g/mol. Its IUPAC name is 2-bromo-4-chloro-6-[(3-chloro-4-methoxyphenyl)iminomethyl]-3,5-dimethylphenol.
| Compound Name | 2-bromo-4-chloro-6-[(3-chloro-4-methoxyphenyl)iminomethyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 3277239 |
| Molecular Formula | C16H14BrCl2NO2 |
| Molecular Weight | 403.10 g/mol |
| Exact Mass | 400.96 |
| IUPAC Name | 2-bromo-4-chloro-6-[(3-chloro-4-methoxyphenyl)iminomethyl]-3,5-dimethylphenol |
| SMILES | COc1ccc(/N=C/c2c(C)c(Cl)c(C)c(Br)c2O)cc1Cl |
| InChI | InChI=1S/C16H14BrCl2NO2/c1-8-11(16(21)14(17)9(2)15(8)19)7-20-10-4-5-13(22-3)12(18)6-10/h4-7,21H,1-3H3/b20-7+ |
| InChIKey | QDYXLXNZFRGOOB-IFRROFPPSA-N |
| XLogP | 5.84 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.10 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|