C17H23ClN2O2S — CID 3281226
3-(4-chlorobenzoyl)-N,N,2-triethyl-1,3-thiazolidine-4-carboxamide (PubChem CID 3281226) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is 3-(4-chlorobenzoyl)-N,N,2-triethyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-(4-chlorobenzoyl)-N,N,2-triethyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 3281226 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3-(4-chlorobenzoyl)-N,N,2-triethyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CCC1SCC(C(=O)N(CC)CC)N1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O2S/c1-4-15-20(16(21)12-7-9-13(18)10-8-12)14(11-23-15)17(22)19(5-2)6-3/h7-10,14-15H,4-6,11H2,1-3H3 |
| InChIKey | ZFDVTAHMRUPYER-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |