C21H31NO4S — CID 3284685
2-(3-cyclopentyloxy-4-methoxyphenyl)-3-(3-propan-2-yloxypropyl)-1,3-thiazolidin-4-one (PubChem CID 3284685) has the molecular formula C21H31NO4S and a molecular weight of 393.55 g/mol. Its IUPAC name is 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-(3-propan-2-yloxypropyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-(3-propan-2-yloxypropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3284685 |
| Molecular Formula | C21H31NO4S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-3-(3-propan-2-yloxypropyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C2SCC(=O)N2CCCOC(C)C)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H31NO4S/c1-15(2)25-12-6-11-22-20(23)14-27-21(22)16-9-10-18(24-3)19(13-16)26-17-7-4-5-8-17/h9-10,13,15,17,21H,4-8,11-12,14H2,1-3H3 |
| InChIKey | YGNCEFITXRABCI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|